About [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane
[2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 101430775) has the molecular formula C30H39P
and a molecular weight of 430.62 g/mol. Its IUPAC name is [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane.
Molecular Properties
| Compound Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane |
| PubChem CID | 101430775 |
| Molecular Formula | C30H39P |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cccc(-c2c(C(C)C)cccc2C(C)C)c1P |
| InChI | InChI=1S/C30H39P/c1-18(2)22-12-9-13-23(19(3)4)28(22)26-16-11-17-27(30(26)31)29-24(20(5)6)14-10-15-25(29)21(7)8/h9-21H,31H2,1-8H3 |
| InChIKey | MRQDQCBYXMNLGB-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane?
The IUPAC name of [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane (CID 101430775) is [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane.
What is the SMILES notation for [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane?
The canonical SMILES for [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane is CC(C)c1cccc(C(C)C)c1-c1cccc(-c2c(C(C)C)cccc2C(C)C)c1P.
What is the InChIKey of [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane?
The InChIKey is MRQDQCBYXMNLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H39P/c1-18(2)22-12-9-13-23(19(3)4)28(22)26-16-11-17-27(30(26)31)29-24(20(5)6)14-10-15-25(29)21(7)8/h9-21H,31H2,1-8H3.
What are the key properties of [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane?
[2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane has a molecular weight of 430.62 g/mol, XLogP of 9.01, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]phosphane is sourced from PubChem (CID 101430775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).