C30H37Cl2NSi — CID 102266315
[2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]imino-dichlorosilane (PubChem CID 102266315) has the molecular formula C30H37Cl2NSi and a molecular weight of 510.63 g/mol. Its IUPAC name is [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]imino-dichlorosilane.
| Compound Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]imino-dichlorosilane |
|---|---|
| PubChem CID | 102266315 |
| Molecular Formula | C30H37Cl2NSi |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]imino-dichlorosilane |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cccc(-c2c(C(C)C)cccc2C(C)C)c1N=[Si](Cl)Cl |
| InChI | InChI=1S/C30H37Cl2NSi/c1-18(2)22-12-9-13-23(19(3)4)28(22)26-16-11-17-27(30(26)33-34(31)32)29-24(20(5)6)14-10-15-25(29)21(7)8/h9-21H,1-8H3 |
| InChIKey | ULPFBXXQFWULCA-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|