C19H22 — CID 160592533
1,8-di(propan-2-yl)-9H-fluorene (PubChem CID 160592533) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,8-di(propan-2-yl)-9H-fluorene.
| Compound Name | 1,8-di(propan-2-yl)-9H-fluorene |
|---|---|
| PubChem CID | 160592533 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1,8-di(propan-2-yl)-9H-fluorene |
| SMILES | CC(C)c1cccc2c1Cc1c-2cccc1C(C)C |
| InChI | InChI=1S/C19H22/c1-12(2)14-7-5-9-16-17-10-6-8-15(13(3)4)19(17)11-18(14)16/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | DXBWCACBJLFVBS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |