About 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride
1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride (PubChem CID 19935939) has the molecular formula C20H18Cl2Zr
and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride.
Molecular Properties
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride |
| PubChem CID | 19935939 |
| Molecular Formula | C20H18Cl2Zr |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride |
| SMILES | CC(C1=CC=CC1)c1cccc2c1Cc1ccccc1-2.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C20H18.2ClH.Zr/c1-14(15-7-2-3-8-15)17-11-6-12-19-18-10-5-4-9-16(18)13-20(17)19;;;/h2-7,9-12,14H,8,13H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SDWAJLZXZAGKJF-UHFFFAOYSA-L |
| XLogP | -0.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride?
The IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride (CID 19935939) is 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride.
What is the SMILES notation for 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride?
The canonical SMILES for 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride is CC(C1=CC=CC1)c1cccc2c1Cc1ccccc1-2.[Cl-].[Cl-].[Zr+2].
What is the InChIKey of 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride?
The InChIKey is SDWAJLZXZAGKJF-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H18.2ClH.Zr/c1-14(15-7-2-3-8-15)17-11-6-12-19-18-10-5-4-9-16(18)13-20(17)19;;;/h2-7,9-12,14H,8,13H2,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride?
1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride has a molecular weight of 420.49 g/mol, XLogP of -0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopenta-1,3-dien-1-ylethyl)-9H-fluorene;zirconium(2+);dichloride is sourced from PubChem (CID 19935939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).