C17H18O3 — CID 141018986
2-(9H-fluoren-1-yl)butane-1,1,1-triol (PubChem CID 141018986) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(9H-fluoren-1-yl)butane-1,1,1-triol.
| Compound Name | 2-(9H-fluoren-1-yl)butane-1,1,1-triol |
|---|---|
| PubChem CID | 141018986 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(9H-fluoren-1-yl)butane-1,1,1-triol |
| SMILES | CCC(c1cccc2c1Cc1ccccc1-2)C(O)(O)O |
| InChI | InChI=1S/C17H18O3/c1-2-16(17(18,19)20)14-9-5-8-13-12-7-4-3-6-11(12)10-15(13)14/h3-9,16,18-20H,2,10H2,1H3 |
| InChIKey | UFNDYARBEYYWLT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|