About ethane;1-ethyl-9H-fluorene;propane
ethane;1-ethyl-9H-fluorene;propane (PubChem CID 167686584) has the molecular formula C20H28
and a molecular weight of 268.44 g/mol. Its IUPAC name is ethane;1-ethyl-9H-fluorene;propane.
Molecular Properties
| Compound Name | ethane;1-ethyl-9H-fluorene;propane |
| PubChem CID | 167686584 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | ethane;1-ethyl-9H-fluorene;propane |
| SMILES | CC.CCC.CCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H14.C3H8.C2H6/c1-2-11-7-5-9-14-13-8-4-3-6-12(13)10-15(11)14;1-3-2;1-2/h3-9H,2,10H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | WHQRAPIHROKHKD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-ethyl-9H-fluorene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-9H-fluorene;propane?
The IUPAC name of ethane;1-ethyl-9H-fluorene;propane (CID 167686584) is ethane;1-ethyl-9H-fluorene;propane.
What is the SMILES notation for ethane;1-ethyl-9H-fluorene;propane?
The canonical SMILES for ethane;1-ethyl-9H-fluorene;propane is CC.CCC.CCc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of ethane;1-ethyl-9H-fluorene;propane?
The InChIKey is WHQRAPIHROKHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.C3H8.C2H6/c1-2-11-7-5-9-14-13-8-4-3-6-12(13)10-15(11)14;1-3-2;1-2/h3-9H,2,10H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-ethyl-9H-fluorene;propane?
ethane;1-ethyl-9H-fluorene;propane has a molecular weight of 268.44 g/mol, XLogP of 6.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-9H-fluorene;propane is sourced from PubChem (CID 167686584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).