About 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene
1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene (PubChem CID 158660658) has the molecular formula C34H36
and a molecular weight of 444.66 g/mol. Its IUPAC name is 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene.
Molecular Properties
| Compound Name | 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene |
| PubChem CID | 158660658 |
| Molecular Formula | C34H36 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene |
| SMILES | CCc1ccc2c(c1)-c1cc(CC)ccc1C2.CCc1ccc2c(c1)-c1cccc(CC)c1C2 |
| InChI | InChI=1S/2C17H18/c1-3-12-5-7-14-11-15-8-6-13(4-2)10-17(15)16(14)9-12;1-3-12-8-9-14-11-17-13(4-2)6-5-7-15(17)16(14)10-12/h2*5-10H,3-4,11H2,1-2H3 |
| InChIKey | ICSGBSXRQDFMHU-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene?
The IUPAC name of 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene (CID 158660658) is 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene.
What is the SMILES notation for 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene?
The canonical SMILES for 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene is CCc1ccc2c(c1)-c1cc(CC)ccc1C2.CCc1ccc2c(c1)-c1cccc(CC)c1C2.
What is the InChIKey of 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene?
The InChIKey is ICSGBSXRQDFMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H18/c1-3-12-5-7-14-11-15-8-6-13(4-2)10-17(15)16(14)9-12;1-3-12-8-9-14-11-17-13(4-2)6-5-7-15(17)16(14)10-12/h2*5-10H,3-4,11H2,1-2H3.
What are the key properties of 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene?
1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene has a molecular weight of 444.66 g/mol, XLogP of 8.77, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethyl-9H-fluorene;3,6-diethyl-9H-fluorene is sourced from PubChem (CID 158660658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).