C13H14 — CID 11116496
1-cyclopenta-1,3-dien-1-ylethylbenzene (PubChem CID 11116496) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylethylbenzene.
| Compound Name | 1-cyclopenta-1,3-dien-1-ylethylbenzene |
|---|---|
| PubChem CID | 11116496 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylethylbenzene |
| SMILES | CC(C1=CC=CC1)c1ccccc1 |
| InChI | InChI=1S/C13H14/c1-11(13-9-5-6-10-13)12-7-3-2-4-8-12/h2-9,11H,10H2,1H3 |
| InChIKey | HIKSIRNCAJVPPW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |