About 1-phenylethylbenzene;stibane
1-phenylethylbenzene;stibane (PubChem CID 174965918) has the molecular formula C14H17Sb
and a molecular weight of 307.05 g/mol. Its IUPAC name is 1-phenylethylbenzene;stibane.
Molecular Properties
| Compound Name | 1-phenylethylbenzene;stibane |
| PubChem CID | 174965918 |
| Molecular Formula | C14H17Sb |
| Molecular Weight | 307.05 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 1-phenylethylbenzene;stibane |
| SMILES | CC(c1ccccc1)c1ccccc1.[SbH3] |
| InChI | InChI=1S/C14H14.Sb.3H/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;;;;/h2-12H,1H3;;;; |
| InChIKey | MGCLCAOMPGWRAX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.05 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethylbenzene;stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethylbenzene;stibane?
The IUPAC name of 1-phenylethylbenzene;stibane (CID 174965918) is 1-phenylethylbenzene;stibane.
What is the SMILES notation for 1-phenylethylbenzene;stibane?
The canonical SMILES for 1-phenylethylbenzene;stibane is CC(c1ccccc1)c1ccccc1.[SbH3].
What is the InChIKey of 1-phenylethylbenzene;stibane?
The InChIKey is MGCLCAOMPGWRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.Sb.3H/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;;;;/h2-12H,1H3;;;;.
What are the key properties of 1-phenylethylbenzene;stibane?
1-phenylethylbenzene;stibane has a molecular weight of 307.05 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethylbenzene;stibane is sourced from PubChem (CID 174965918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).