About ethane;2-fluorobutane;1-phenylethylbenzene
ethane;2-fluorobutane;1-phenylethylbenzene (PubChem CID 142933891) has the molecular formula C20H29F
and a molecular weight of 288.45 g/mol. Its IUPAC name is ethane;2-fluorobutane;1-phenylethylbenzene.
Molecular Properties
| Compound Name | ethane;2-fluorobutane;1-phenylethylbenzene |
| PubChem CID | 142933891 |
| Molecular Formula | C20H29F |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | ethane;2-fluorobutane;1-phenylethylbenzene |
| SMILES | CC.CC(c1ccccc1)c1ccccc1.CCC(C)F |
| InChI | InChI=1S/C14H14.C4H9F.C2H6/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-4(2)5;1-2/h2-12H,1H3;4H,3H2,1-2H3;1-2H3 |
| InChIKey | IFSRLXQJPYXQPX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-fluorobutane;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluorobutane;1-phenylethylbenzene?
The IUPAC name of ethane;2-fluorobutane;1-phenylethylbenzene (CID 142933891) is ethane;2-fluorobutane;1-phenylethylbenzene.
What is the SMILES notation for ethane;2-fluorobutane;1-phenylethylbenzene?
The canonical SMILES for ethane;2-fluorobutane;1-phenylethylbenzene is CC.CC(c1ccccc1)c1ccccc1.CCC(C)F.
What is the InChIKey of ethane;2-fluorobutane;1-phenylethylbenzene?
The InChIKey is IFSRLXQJPYXQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C4H9F.C2H6/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-4(2)5;1-2/h2-12H,1H3;4H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;2-fluorobutane;1-phenylethylbenzene?
ethane;2-fluorobutane;1-phenylethylbenzene has a molecular weight of 288.45 g/mol, XLogP of 6.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluorobutane;1-phenylethylbenzene is sourced from PubChem (CID 142933891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).