About ethanamine;1-phenylethylbenzene
ethanamine;1-phenylethylbenzene (PubChem CID 19985218) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is ethanamine;1-phenylethylbenzene.
Molecular Properties
| Compound Name | ethanamine;1-phenylethylbenzene |
| PubChem CID | 19985218 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | ethanamine;1-phenylethylbenzene |
| SMILES | CC(c1ccccc1)c1ccccc1.CCN |
| InChI | InChI=1S/C14H14.C2H7N/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-3/h2-12H,1H3;2-3H2,1H3 |
| InChIKey | NAGXARGCDYMMSE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanamine;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1-phenylethylbenzene?
The IUPAC name of ethanamine;1-phenylethylbenzene (CID 19985218) is ethanamine;1-phenylethylbenzene.
What is the SMILES notation for ethanamine;1-phenylethylbenzene?
The canonical SMILES for ethanamine;1-phenylethylbenzene is CC(c1ccccc1)c1ccccc1.CCN.
What is the InChIKey of ethanamine;1-phenylethylbenzene?
The InChIKey is NAGXARGCDYMMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H7N/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2-3/h2-12H,1H3;2-3H2,1H3.
What are the key properties of ethanamine;1-phenylethylbenzene?
ethanamine;1-phenylethylbenzene has a molecular weight of 227.35 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1-phenylethylbenzene is sourced from PubChem (CID 19985218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).