About isocyanic acid;1-phenylethylbenzene
isocyanic acid;1-phenylethylbenzene (PubChem CID 172750897) has the molecular formula C19H19N5O5
and a molecular weight of 397.39 g/mol. Its IUPAC name is isocyanic acid;1-phenylethylbenzene.
Molecular Properties
| Compound Name | isocyanic acid;1-phenylethylbenzene |
| PubChem CID | 172750897 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | isocyanic acid;1-phenylethylbenzene |
| SMILES | CC(c1ccccc1)c1ccccc1.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O |
| InChI | InChI=1S/C14H14.5CHNO/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;5*2-1-3/h2-12H,1H3;5*2H |
| InChIKey | KIYWDYHUVICQPH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 204.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;1-phenylethylbenzene?
The IUPAC name of isocyanic acid;1-phenylethylbenzene (CID 172750897) is isocyanic acid;1-phenylethylbenzene.
What is the SMILES notation for isocyanic acid;1-phenylethylbenzene?
The canonical SMILES for isocyanic acid;1-phenylethylbenzene is CC(c1ccccc1)c1ccccc1.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.
What is the InChIKey of isocyanic acid;1-phenylethylbenzene?
The InChIKey is KIYWDYHUVICQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.5CHNO/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;5*2-1-3/h2-12H,1H3;5*2H.
What are the key properties of isocyanic acid;1-phenylethylbenzene?
isocyanic acid;1-phenylethylbenzene has a molecular weight of 397.39 g/mol, XLogP of 3.34, 2 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;1-phenylethylbenzene is sourced from PubChem (CID 172750897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).