About 1-bromoethylbenzene;isocyanic acid
1-bromoethylbenzene;isocyanic acid (PubChem CID 154983763) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 1-bromoethylbenzene;isocyanic acid.
Molecular Properties
| Compound Name | 1-bromoethylbenzene;isocyanic acid |
| PubChem CID | 154983763 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 1-bromoethylbenzene;isocyanic acid |
| SMILES | CC(Br)c1ccccc1.N=C=O |
| InChI | InChI=1S/C8H9Br.CHNO/c1-7(9)8-5-3-2-4-6-8;2-1-3/h2-7H,1H3;2H |
| InChIKey | SISSFPQUCRQWDD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethylbenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethylbenzene;isocyanic acid?
The IUPAC name of 1-bromoethylbenzene;isocyanic acid (CID 154983763) is 1-bromoethylbenzene;isocyanic acid.
What is the SMILES notation for 1-bromoethylbenzene;isocyanic acid?
The canonical SMILES for 1-bromoethylbenzene;isocyanic acid is CC(Br)c1ccccc1.N=C=O.
What is the InChIKey of 1-bromoethylbenzene;isocyanic acid?
The InChIKey is SISSFPQUCRQWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br.CHNO/c1-7(9)8-5-3-2-4-6-8;2-1-3/h2-7H,1H3;2H.
What are the key properties of 1-bromoethylbenzene;isocyanic acid?
1-bromoethylbenzene;isocyanic acid has a molecular weight of 228.09 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethylbenzene;isocyanic acid is sourced from PubChem (CID 154983763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).