carbon dioxide;N-methyl-1-phenylethanamine

C10H13NO2 — CID 91452394

IUPACcarbon dioxide;N-methyl-1-phenylethanamine
SMILESCNC(C)c1ccccc1.O=C=O
InChIInChI=1S/C9H13N.CO2/c1-8(10-2)9-6-4-3-5-7-9;2-1-3/h3-8,10H,1-2H3;
InChIKeyYGQDGLWJLWYCIM-UHFFFAOYSA-N
MW179.22 g/mol
LogP1.38
Rot. Bonds2

About carbon dioxide;N-methyl-1-phenylethanamine

carbon dioxide;N-methyl-1-phenylethanamine (PubChem CID 91452394) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is carbon dioxide;N-methyl-1-phenylethanamine.

Molecular Properties

Compound Namecarbon dioxide;N-methyl-1-phenylethanamine
PubChem CID91452394
Molecular FormulaC10H13NO2
Molecular Weight179.22 g/mol
Exact Mass179.09
IUPAC Namecarbon dioxide;N-methyl-1-phenylethanamine
SMILESCNC(C)c1ccccc1.O=C=O
InChIInChI=1S/C9H13N.CO2/c1-8(10-2)9-6-4-3-5-7-9;2-1-3/h3-8,10H,1-2H3;
InChIKeyYGQDGLWJLWYCIM-UHFFFAOYSA-N
XLogP1.38
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.22
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze carbon dioxide;N-methyl-1-phenylethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;N-methyl-1-phenylethanamine?
The IUPAC name of carbon dioxide;N-methyl-1-phenylethanamine (CID 91452394) is carbon dioxide;N-methyl-1-phenylethanamine.
What is the SMILES notation for carbon dioxide;N-methyl-1-phenylethanamine?
The canonical SMILES for carbon dioxide;N-methyl-1-phenylethanamine is CNC(C)c1ccccc1.O=C=O.
What is the InChIKey of carbon dioxide;N-methyl-1-phenylethanamine?
The InChIKey is YGQDGLWJLWYCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.CO2/c1-8(10-2)9-6-4-3-5-7-9;2-1-3/h3-8,10H,1-2H3;.
What are the key properties of carbon dioxide;N-methyl-1-phenylethanamine?
carbon dioxide;N-methyl-1-phenylethanamine has a molecular weight of 179.22 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;N-methyl-1-phenylethanamine is sourced from PubChem (CID 91452394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).