About 1-bromoethylbenzene
1-bromoethylbenzene (PubChem CID 11454) has the molecular formula C8H9Br
and a molecular weight of 185.06 g/mol. Its IUPAC name is 1-bromoethylbenzene.
Molecular Properties
| Compound Name | 1-bromoethylbenzene |
| PubChem CID | 11454 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 1-bromoethylbenzene |
| SMILES | CC(Br)c1ccccc1 |
| InChI | InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | CRRUGYDDEMGVDY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethylbenzene?
The IUPAC name of 1-bromoethylbenzene (CID 11454) is 1-bromoethylbenzene.
What is the SMILES notation for 1-bromoethylbenzene?
The canonical SMILES for 1-bromoethylbenzene is CC(Br)c1ccccc1.
What is the InChIKey of 1-bromoethylbenzene?
The InChIKey is CRRUGYDDEMGVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-bromoethylbenzene?
1-bromoethylbenzene has a molecular weight of 185.06 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethylbenzene is sourced from PubChem (CID 11454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).