About cumene;hydrogen peroxide
cumene;hydrogen peroxide (PubChem CID 21225480) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is cumene;hydrogen peroxide.
Molecular Properties
| Compound Name | cumene;hydrogen peroxide |
| PubChem CID | 21225480 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | cumene;hydrogen peroxide |
| SMILES | CC(C)c1ccccc1.OO |
| InChI | InChI=1S/C9H12.H2O2/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H |
| InChIKey | MRIZMKJLUDDMHF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze cumene;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;hydrogen peroxide?
The IUPAC name of cumene;hydrogen peroxide (CID 21225480) is cumene;hydrogen peroxide.
What is the SMILES notation for cumene;hydrogen peroxide?
The canonical SMILES for cumene;hydrogen peroxide is CC(C)c1ccccc1.OO.
What is the InChIKey of cumene;hydrogen peroxide?
The InChIKey is MRIZMKJLUDDMHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.H2O2/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H.
What are the key properties of cumene;hydrogen peroxide?
cumene;hydrogen peroxide has a molecular weight of 154.21 g/mol, XLogP of 2.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;hydrogen peroxide is sourced from PubChem (CID 21225480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).