About cumene;zinc
cumene;zinc (PubChem CID 159490121) has the molecular formula C9H12Zn
and a molecular weight of 185.59 g/mol. Its IUPAC name is cumene;zinc.
Molecular Properties
| Compound Name | cumene;zinc |
| PubChem CID | 159490121 |
| Molecular Formula | C9H12Zn |
| Molecular Weight | 185.59 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | cumene;zinc |
| SMILES | CC(C)c1ccccc1.[Zn] |
| InChI | InChI=1S/C9H12.Zn/c1-8(2)9-6-4-3-5-7-9;/h3-8H,1-2H3; |
| InChIKey | LYBUFFXZSPKRKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cumene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;zinc?
The IUPAC name of cumene;zinc (CID 159490121) is cumene;zinc.
What is the SMILES notation for cumene;zinc?
The canonical SMILES for cumene;zinc is CC(C)c1ccccc1.[Zn].
What is the InChIKey of cumene;zinc?
The InChIKey is LYBUFFXZSPKRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.Zn/c1-8(2)9-6-4-3-5-7-9;/h3-8H,1-2H3;.
What are the key properties of cumene;zinc?
cumene;zinc has a molecular weight of 185.59 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;zinc is sourced from PubChem (CID 159490121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).