About copper;cumene;manganese
copper;cumene;manganese (PubChem CID 175691003) has the molecular formula C9H12CuMn
and a molecular weight of 238.68 g/mol. Its IUPAC name is copper;cumene;manganese.
Molecular Properties
| Compound Name | copper;cumene;manganese |
| PubChem CID | 175691003 |
| Molecular Formula | C9H12CuMn |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | copper;cumene;manganese |
| SMILES | CC(C)c1ccccc1.[Cu].[Mn] |
| InChI | InChI=1S/C9H12.Cu.Mn/c1-8(2)9-6-4-3-5-7-9;;/h3-8H,1-2H3;; |
| InChIKey | DHGHBKRYHGORFG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze copper;cumene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;cumene;manganese?
The IUPAC name of copper;cumene;manganese (CID 175691003) is copper;cumene;manganese.
What is the SMILES notation for copper;cumene;manganese?
The canonical SMILES for copper;cumene;manganese is CC(C)c1ccccc1.[Cu].[Mn].
What is the InChIKey of copper;cumene;manganese?
The InChIKey is DHGHBKRYHGORFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.Cu.Mn/c1-8(2)9-6-4-3-5-7-9;;/h3-8H,1-2H3;;.
What are the key properties of copper;cumene;manganese?
copper;cumene;manganese has a molecular weight of 238.68 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;cumene;manganese is sourced from PubChem (CID 175691003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).