About cumene;ethane
cumene;ethane (PubChem CID 54306132) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is cumene;ethane.
Molecular Properties
| Compound Name | cumene;ethane |
| PubChem CID | 54306132 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | cumene;ethane |
| SMILES | CC.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.C2H6/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | SHQHRDPILKDALG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethane?
The IUPAC name of cumene;ethane (CID 54306132) is cumene;ethane.
What is the SMILES notation for cumene;ethane?
The canonical SMILES for cumene;ethane is CC.CC(C)c1ccccc1.
What is the InChIKey of cumene;ethane?
The InChIKey is SHQHRDPILKDALG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C2H6/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H3.
What are the key properties of cumene;ethane?
cumene;ethane has a molecular weight of 150.26 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethane is sourced from PubChem (CID 54306132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).