About cumene;ethane;bis(2-methylpropane)
cumene;ethane;bis(2-methylpropane) (PubChem CID 161044029) has the molecular formula C19H38
and a molecular weight of 266.51 g/mol. Its IUPAC name is cumene;ethane;bis(2-methylpropane).
Molecular Properties
| Compound Name | cumene;ethane;bis(2-methylpropane) |
| PubChem CID | 161044029 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | cumene;ethane;bis(2-methylpropane) |
| SMILES | CC.CC(C)C.CC(C)C.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.2C4H10.C2H6/c1-8(2)9-6-4-3-5-7-9;2*1-4(2)3;1-2/h3-8H,1-2H3;2*4H,1-3H3;1-2H3 |
| InChIKey | UBGJPIHBDGJZFA-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ethane;bis(2-methylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethane;bis(2-methylpropane)?
The IUPAC name of cumene;ethane;bis(2-methylpropane) (CID 161044029) is cumene;ethane;bis(2-methylpropane).
What is the SMILES notation for cumene;ethane;bis(2-methylpropane)?
The canonical SMILES for cumene;ethane;bis(2-methylpropane) is CC.CC(C)C.CC(C)C.CC(C)c1ccccc1.
What is the InChIKey of cumene;ethane;bis(2-methylpropane)?
The InChIKey is UBGJPIHBDGJZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C4H10.C2H6/c1-8(2)9-6-4-3-5-7-9;2*1-4(2)3;1-2/h3-8H,1-2H3;2*4H,1-3H3;1-2H3.
What are the key properties of cumene;ethane;bis(2-methylpropane)?
cumene;ethane;bis(2-methylpropane) has a molecular weight of 266.51 g/mol, XLogP of 7.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethane;bis(2-methylpropane) is sourced from PubChem (CID 161044029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).