About cumene;2-methylpropane;propane
cumene;2-methylpropane;propane (PubChem CID 158125037) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is cumene;2-methylpropane;propane.
Molecular Properties
| Compound Name | cumene;2-methylpropane;propane |
| PubChem CID | 158125037 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | cumene;2-methylpropane;propane |
| SMILES | CC(C)C.CC(C)c1ccccc1.CCC |
| InChI | InChI=1S/C9H12.C4H10.C3H8/c1-8(2)9-6-4-3-5-7-9;1-4(2)3;1-3-2/h3-8H,1-2H3;4H,1-3H3;3H2,1-2H3 |
| InChIKey | FSBJERJMANKULY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;2-methylpropane;propane?
The IUPAC name of cumene;2-methylpropane;propane (CID 158125037) is cumene;2-methylpropane;propane.
What is the SMILES notation for cumene;2-methylpropane;propane?
The canonical SMILES for cumene;2-methylpropane;propane is CC(C)C.CC(C)c1ccccc1.CCC.
What is the InChIKey of cumene;2-methylpropane;propane?
The InChIKey is FSBJERJMANKULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C4H10.C3H8/c1-8(2)9-6-4-3-5-7-9;1-4(2)3;1-3-2/h3-8H,1-2H3;4H,1-3H3;3H2,1-2H3.
What are the key properties of cumene;2-methylpropane;propane?
cumene;2-methylpropane;propane has a molecular weight of 222.42 g/mol, XLogP of 5.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;2-methylpropane;propane is sourced from PubChem (CID 158125037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).