About cumene;methanethiol
cumene;methanethiol (PubChem CID 170640582) has the molecular formula C10H16S
and a molecular weight of 168.30 g/mol. Its IUPAC name is cumene;methanethiol.
Molecular Properties
| Compound Name | cumene;methanethiol |
| PubChem CID | 170640582 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | cumene;methanethiol |
| SMILES | CC(C)c1ccccc1.CS |
| InChI | InChI=1S/C9H12.CH4S/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;2H,1H3 |
| InChIKey | SCHFBCGXGCAHPA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cumene;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;methanethiol?
The IUPAC name of cumene;methanethiol (CID 170640582) is cumene;methanethiol.
What is the SMILES notation for cumene;methanethiol?
The canonical SMILES for cumene;methanethiol is CC(C)c1ccccc1.CS.
What is the InChIKey of cumene;methanethiol?
The InChIKey is SCHFBCGXGCAHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.CH4S/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;2H,1H3.
What are the key properties of cumene;methanethiol?
cumene;methanethiol has a molecular weight of 168.30 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;methanethiol is sourced from PubChem (CID 170640582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).