About cumene;ruthenium(2+);dichloride
cumene;ruthenium(2+);dichloride (PubChem CID 23094461) has the molecular formula C9H12Cl2Ru
and a molecular weight of 292.17 g/mol. Its IUPAC name is cumene;ruthenium(2+);dichloride.
Molecular Properties
| Compound Name | cumene;ruthenium(2+);dichloride |
| PubChem CID | 23094461 |
| Molecular Formula | C9H12Cl2Ru |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | cumene;ruthenium(2+);dichloride |
| SMILES | CC(C)c1ccccc1.[Cl-].[Cl-].[Ru+2] |
| InChI | InChI=1S/C9H12.2ClH.Ru/c1-8(2)9-6-4-3-5-7-9;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | HXFLHQSZXLTPSH-UHFFFAOYSA-L |
| XLogP | -3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ruthenium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ruthenium(2+);dichloride?
The IUPAC name of cumene;ruthenium(2+);dichloride (CID 23094461) is cumene;ruthenium(2+);dichloride.
What is the SMILES notation for cumene;ruthenium(2+);dichloride?
The canonical SMILES for cumene;ruthenium(2+);dichloride is CC(C)c1ccccc1.[Cl-].[Cl-].[Ru+2].
What is the InChIKey of cumene;ruthenium(2+);dichloride?
The InChIKey is HXFLHQSZXLTPSH-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H12.2ClH.Ru/c1-8(2)9-6-4-3-5-7-9;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of cumene;ruthenium(2+);dichloride?
cumene;ruthenium(2+);dichloride has a molecular weight of 292.17 g/mol, XLogP of -3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ruthenium(2+);dichloride is sourced from PubChem (CID 23094461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).