About cumene;ethane;1-phenylethylbenzene
cumene;ethane;1-phenylethylbenzene (PubChem CID 158118082) has the molecular formula C29H44
and a molecular weight of 392.67 g/mol. Its IUPAC name is cumene;ethane;1-phenylethylbenzene.
Molecular Properties
| Compound Name | cumene;ethane;1-phenylethylbenzene |
| PubChem CID | 158118082 |
| Molecular Formula | C29H44 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | cumene;ethane;1-phenylethylbenzene |
| SMILES | CC.CC.CC.CC(C)c1ccccc1.CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14.C9H12.3C2H6/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-8(2)9-6-4-3-5-7-9;3*1-2/h2-12H,1H3;3-8H,1-2H3;3*1-2H3 |
| InChIKey | FRGNTUXHTPUSBW-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ethane;1-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethane;1-phenylethylbenzene?
The IUPAC name of cumene;ethane;1-phenylethylbenzene (CID 158118082) is cumene;ethane;1-phenylethylbenzene.
What is the SMILES notation for cumene;ethane;1-phenylethylbenzene?
The canonical SMILES for cumene;ethane;1-phenylethylbenzene is CC.CC.CC.CC(C)c1ccccc1.CC(c1ccccc1)c1ccccc1.
What is the InChIKey of cumene;ethane;1-phenylethylbenzene?
The InChIKey is FRGNTUXHTPUSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C9H12.3C2H6/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-8(2)9-6-4-3-5-7-9;3*1-2/h2-12H,1H3;3-8H,1-2H3;3*1-2H3.
What are the key properties of cumene;ethane;1-phenylethylbenzene?
cumene;ethane;1-phenylethylbenzene has a molecular weight of 392.67 g/mol, XLogP of 9.73, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethane;1-phenylethylbenzene is sourced from PubChem (CID 158118082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).