About CID 87136222
CID 87136222 (PubChem CID 87136222) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol.
Molecular Properties
| Compound Name | CID 87136222 |
| PubChem CID | 87136222 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccccc1.OOO |
| InChI | InChI=1S/C9H12.H2O3/c1-8(2)9-6-4-3-5-7-9;1-3-2/h3-8H,1-2H3;1-2H |
| InChIKey | CJGQCZLCSHUFMG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 87136222 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87136222?
The IUPAC name of CID 87136222 (CID 87136222) is not available.
What is the SMILES notation for CID 87136222?
The canonical SMILES for CID 87136222 is CC(C)c1ccccc1.OOO.
What is the InChIKey of CID 87136222?
The InChIKey is CJGQCZLCSHUFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.H2O3/c1-8(2)9-6-4-3-5-7-9;1-3-2/h3-8H,1-2H3;1-2H.
What are the key properties of CID 87136222?
CID 87136222 has a molecular weight of 170.21 g/mol, XLogP of 2.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87136222 is sourced from PubChem (CID 87136222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).