About cumene;hydroxy hypofluorite
cumene;hydroxy hypofluorite (PubChem CID 175445754) has the molecular formula C9H13FO2
and a molecular weight of 172.20 g/mol. Its IUPAC name is cumene;hydroxy hypofluorite.
Molecular Properties
| Compound Name | cumene;hydroxy hypofluorite |
| PubChem CID | 175445754 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | cumene;hydroxy hypofluorite |
| SMILES | CC(C)c1ccccc1.OOF |
| InChI | InChI=1S/C9H12.FHO2/c1-8(2)9-6-4-3-5-7-9;1-3-2/h3-8H,1-2H3;2H |
| InChIKey | OBPYQRGTHYKGQJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze cumene;hydroxy hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;hydroxy hypofluorite?
The IUPAC name of cumene;hydroxy hypofluorite (CID 175445754) is cumene;hydroxy hypofluorite.
What is the SMILES notation for cumene;hydroxy hypofluorite?
The canonical SMILES for cumene;hydroxy hypofluorite is CC(C)c1ccccc1.OOF.
What is the InChIKey of cumene;hydroxy hypofluorite?
The InChIKey is OBPYQRGTHYKGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.FHO2/c1-8(2)9-6-4-3-5-7-9;1-3-2/h3-8H,1-2H3;2H.
What are the key properties of cumene;hydroxy hypofluorite?
cumene;hydroxy hypofluorite has a molecular weight of 172.20 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;hydroxy hypofluorite is sourced from PubChem (CID 175445754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).