About CID 174377533
CID 174377533 (PubChem CID 174377533) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol.
Molecular Properties
| Compound Name | CID 174377533 |
| PubChem CID | 174377533 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccccc1.NF |
| InChI | InChI=1S/C9H12.FH2N/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;2H2 |
| InChIKey | XMGKYVDPPXVSRS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 174377533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174377533?
The IUPAC name of CID 174377533 (CID 174377533) is not available.
What is the SMILES notation for CID 174377533?
The canonical SMILES for CID 174377533 is CC(C)c1ccccc1.NF.
What is the InChIKey of CID 174377533?
The InChIKey is XMGKYVDPPXVSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.FH2N/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;2H2.
What are the key properties of CID 174377533?
CID 174377533 has a molecular weight of 155.22 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174377533 is sourced from PubChem (CID 174377533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).