About cumene;2-hydroperoxypropan-2-ol
cumene;2-hydroperoxypropan-2-ol (PubChem CID 175197526) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is cumene;2-hydroperoxypropan-2-ol.
Molecular Properties
| Compound Name | cumene;2-hydroperoxypropan-2-ol |
| PubChem CID | 175197526 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cumene;2-hydroperoxypropan-2-ol |
| SMILES | CC(C)(O)OO.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.C3H8O3/c1-8(2)9-6-4-3-5-7-9;1-3(2,4)6-5/h3-8H,1-2H3;4-5H,1-2H3 |
| InChIKey | MNCRURZPCDELKM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze cumene;2-hydroperoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;2-hydroperoxypropan-2-ol?
The IUPAC name of cumene;2-hydroperoxypropan-2-ol (CID 175197526) is cumene;2-hydroperoxypropan-2-ol.
What is the SMILES notation for cumene;2-hydroperoxypropan-2-ol?
The canonical SMILES for cumene;2-hydroperoxypropan-2-ol is CC(C)(O)OO.CC(C)c1ccccc1.
What is the InChIKey of cumene;2-hydroperoxypropan-2-ol?
The InChIKey is MNCRURZPCDELKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C3H8O3/c1-8(2)9-6-4-3-5-7-9;1-3(2,4)6-5/h3-8H,1-2H3;4-5H,1-2H3.
What are the key properties of cumene;2-hydroperoxypropan-2-ol?
cumene;2-hydroperoxypropan-2-ol has a molecular weight of 212.29 g/mol, XLogP of 3.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;2-hydroperoxypropan-2-ol is sourced from PubChem (CID 175197526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).