About 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium
1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium (PubChem CID 145295082) has the molecular formula C14H16Os
and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium |
| PubChem CID | 145295082 |
| Molecular Formula | C14H16Os |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium |
| SMILES | CC(C1=CC=CCC1)c1ccccc1.[Os] |
| InChI | InChI=1S/C14H16.Os/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-6,8-10,12H,7,11H2,1H3; |
| InChIKey | SNPKQVCPOPXKJR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium?
The IUPAC name of 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium (CID 145295082) is 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium is CC(C1=CC=CCC1)c1ccccc1.[Os].
What is the InChIKey of 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium?
The InChIKey is SNPKQVCPOPXKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16.Os/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-6,8-10,12H,7,11H2,1H3;.
What are the key properties of 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium?
1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium has a molecular weight of 374.51 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium is sourced from PubChem (CID 145295082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).