C14H16Os — CID 145295082
1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium (PubChem CID 145295082) has the molecular formula C14H16Os and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium.
| Compound Name | 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium |
|---|---|
| PubChem CID | 145295082 |
| Molecular Formula | C14H16Os |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylethylbenzene;osmium |
| SMILES | CC(C1=CC=CCC1)c1ccccc1.[Os] |
| InChI | InChI=1S/C14H16.Os/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-6,8-10,12H,7,11H2,1H3; |
| InChIKey | SNPKQVCPOPXKJR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |