C15H17NO2 — CID 71096762
(2S)-2-amino-3-cyclohexa-1,3-dien-1-yl-3-phenylpropanoic acid (PubChem CID 71096762) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexa-1,3-dien-1-yl-3-phenylpropanoic acid.
| Compound Name | (2S)-2-amino-3-cyclohexa-1,3-dien-1-yl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71096762 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2S)-2-amino-3-cyclohexa-1,3-dien-1-yl-3-phenylpropanoic acid |
| SMILES | N[C@H](C(=O)O)C(C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-5,7-9,13-14H,6,10,16H2,(H,17,18)/t13?,14-/m0/s1 |
| InChIKey | IFIPZMFNRDNXPR-KZUDCZAMSA-N |
| XLogP | 2.46 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |