C12H14Si — CID 154538324
cyclohexa-1,3-dien-1-yl(phenyl)silane (PubChem CID 154538324) has the molecular formula C12H14Si and a molecular weight of 186.33 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl(phenyl)silane.
| Compound Name | cyclohexa-1,3-dien-1-yl(phenyl)silane |
|---|---|
| PubChem CID | 154538324 |
| Molecular Formula | C12H14Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl(phenyl)silane |
| SMILES | C1=CCCC([SiH2]c2ccccc2)=C1 |
| InChI | InChI=1S/C12H14Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-5,7-9H,6,10,13H2 |
| InChIKey | GKUZJLRPVFEBBW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|