C25H34 — CID 144821200
1-butan-2-ylcyclohexa-1,3-diene;toluene;1,4-xylene (PubChem CID 144821200) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-butan-2-ylcyclohexa-1,3-diene;toluene;1,4-xylene.
| Compound Name | 1-butan-2-ylcyclohexa-1,3-diene;toluene;1,4-xylene |
|---|---|
| PubChem CID | 144821200 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-butan-2-ylcyclohexa-1,3-diene;toluene;1,4-xylene |
| SMILES | CCC(C)C1=CC=CCC1.Cc1ccc(C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C10H16.C8H10.C7H8/c1-3-9(2)10-7-5-4-6-8-10;1-7-3-5-8(2)6-4-7;1-7-5-3-2-4-6-7/h4-5,7,9H,3,6,8H2,1-2H3;3-6H,1-2H3;2-6H,1H3 |
| InChIKey | JSKNVTMOVVPJRF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |