C9H13Br — CID 10921559
1-[(2R)-1-bromopropan-2-yl]cyclohexa-1,3-diene (PubChem CID 10921559) has the molecular formula C9H13Br and a molecular weight of 201.11 g/mol. Its IUPAC name is 1-[(2R)-1-bromopropan-2-yl]cyclohexa-1,3-diene.
| Compound Name | 1-[(2R)-1-bromopropan-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 10921559 |
| Molecular Formula | C9H13Br |
| Molecular Weight | 201.11 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1-[(2R)-1-bromopropan-2-yl]cyclohexa-1,3-diene |
| SMILES | C[C@@H](CBr)C1=CC=CCC1 |
| InChI | InChI=1S/C9H13Br/c1-8(7-10)9-5-3-2-4-6-9/h2-3,5,8H,4,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | HYIPSCQBPSULMO-QMMMGPOBSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.11 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|