C10H16O — CID 123563743
3-cyclohexa-1,3-dien-1-ylbutan-1-ol (PubChem CID 123563743) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-ylbutan-1-ol.
| Compound Name | 3-cyclohexa-1,3-dien-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 123563743 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-ylbutan-1-ol |
| SMILES | CC(CCO)C1=CC=CCC1 |
| InChI | InChI=1S/C10H16O/c1-9(7-8-11)10-5-3-2-4-6-10/h2-3,5,9,11H,4,6-8H2,1H3 |
| InChIKey | RQWAGEAEYHLKSV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |