C27H47ClO — CID 172834742
1-[chloro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]methyl]cyclohexa-1,3-diene (PubChem CID 172834742) has the molecular formula C27H47ClO and a molecular weight of 423.13 g/mol. Its IUPAC name is 1-[chloro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]methyl]cyclohexa-1,3-diene.
| Compound Name | 1-[chloro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]methyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 172834742 |
| Molecular Formula | C27H47ClO |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | 1-[chloro-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]methyl]cyclohexa-1,3-diene |
| SMILES | C/C(=C\COC(Cl)C1=CC=CCC1)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C27H47ClO/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-29-27(28)26-18-7-6-8-19-26/h6-7,18,20,22-24,27H,8-17,19,21H2,1-5H3/b25-20+/t23-,24-,27?/m1/s1 |
| InChIKey | VZPFTRCQRYWOKF-IGZWYNLASA-N |
| XLogP | 9.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|