C50H94O4 — CID 173326109
bis[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] decanedioate (PubChem CID 173326109) has the molecular formula C50H94O4 and a molecular weight of 759.30 g/mol. Its IUPAC name is bis[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] decanedioate.
| Compound Name | bis[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] decanedioate |
|---|---|
| PubChem CID | 173326109 |
| Molecular Formula | C50H94O4 |
| Molecular Weight | 759.30 g/mol |
| Exact Mass | 758.72 |
| IUPAC Name | bis[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] decanedioate |
| SMILES | CC(=CCOC(=O)CCCCCCCCC(=O)OCC=C(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C50H94O4/c1-41(2)23-17-25-43(5)27-19-29-45(7)31-21-33-47(9)37-39-53-49(51)35-15-13-11-12-14-16-36-50(52)54-40-38-48(10)34-22-32-46(8)30-20-28-44(6)26-18-24-42(3)4/h37-38,41-46H,11-36,39-40H2,1-10H3/t43-,44-,45-,46-/m1/s1 |
| InChIKey | RQBIUJINMQQZNL-AXRJLGSNSA-N |
| XLogP | 15.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.30 |
| LogP ≤ 5 | 15.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|