C34H62O4 — CID 162364376
4-O-(4-tert-butylcyclohexyl) 1-O-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] butanedioate (PubChem CID 162364376) has the molecular formula C34H62O4 and a molecular weight of 534.87 g/mol. Its IUPAC name is 4-O-(4-tert-butylcyclohexyl) 1-O-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] butanedioate.
| Compound Name | 4-O-(4-tert-butylcyclohexyl) 1-O-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] butanedioate |
|---|---|
| PubChem CID | 162364376 |
| Molecular Formula | C34H62O4 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 534.46 |
| IUPAC Name | 4-O-(4-tert-butylcyclohexyl) 1-O-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] butanedioate |
| SMILES | C/C(=C\COC(=O)CCC(=O)OC1CCC(C(C)(C)C)CC1)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C34H62O4/c1-26(2)12-9-13-27(3)14-10-15-28(4)16-11-17-29(5)24-25-37-32(35)22-23-33(36)38-31-20-18-30(19-21-31)34(6,7)8/h24,26-28,30-31H,9-23,25H2,1-8H3/b29-24+/t27-,28-,30?,31?/m1/s1 |
| InChIKey | SDHAUBVZKHYSNW-IRCREKEDSA-N |
| XLogP | 9.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|