C41H78O — CID 6272650
(14E,19E)-2,6,10,14,20,24,28,32-octamethyltritriaconta-14,19-dien-17-one (PubChem CID 6272650) has the molecular formula C41H78O and a molecular weight of 587.07 g/mol. Its IUPAC name is (14E,19E)-2,6,10,14,20,24,28,32-octamethyltritriaconta-14,19-dien-17-one.
| Compound Name | (14E,19E)-2,6,10,14,20,24,28,32-octamethyltritriaconta-14,19-dien-17-one |
|---|---|
| PubChem CID | 6272650 |
| Molecular Formula | C41H78O |
| Molecular Weight | 587.07 g/mol |
| Exact Mass | 586.61 |
| IUPAC Name | (14E,19E)-2,6,10,14,20,24,28,32-octamethyltritriaconta-14,19-dien-17-one |
| SMILES | C/C(=C\CC(=O)C/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C41H78O/c1-33(2)17-11-19-35(5)21-13-23-37(7)25-15-27-39(9)29-31-41(42)32-30-40(10)28-16-26-38(8)24-14-22-36(6)20-12-18-34(3)4/h29-30,33-38H,11-28,31-32H2,1-10H3/b39-29+,40-30+ |
| InChIKey | QDODCFMDVOQVTB-NXRKLTDKSA-N |
| XLogP | 14.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.07 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|