C20H40OPb — CID 160640482
CID 160640482 (PubChem CID 160640482) has the molecular formula C20H40OPb and a molecular weight of 503.74 g/mol.
| Compound Name | CID 160640482 |
|---|---|
| PubChem CID | 160640482 |
| Molecular Formula | C20H40OPb |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | — |
| SMILES | C/C(=C\CO)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[Pb] |
| InChI | InChI=1S/C20H40O.Pb/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21;/h15,17-19,21H,6-14,16H2,1-5H3;/b20-15+;/t18-,19-;/m1./s1 |
| InChIKey | RJCLWRLIPMECTC-IZKFDIQUSA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|