C16H29N — CID 88939328
(E)-4,8,12-trimethyltridec-3-enenitrile (PubChem CID 88939328) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (E)-4,8,12-trimethyltridec-3-enenitrile.
| Compound Name | (E)-4,8,12-trimethyltridec-3-enenitrile |
|---|---|
| PubChem CID | 88939328 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (E)-4,8,12-trimethyltridec-3-enenitrile |
| SMILES | C/C(=C\CC#N)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C16H29N/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17/h12,14-15H,5-11H2,1-4H3/b16-12+ |
| InChIKey | DBFBSDXDDRGYGJ-FOWTUZBSSA-N |
| XLogP | 5.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|