C36H72O — CID 174796442
(E)-3,7,11,15,20,24,28-heptamethylnonacos-2-en-1-ol (PubChem CID 174796442) has the molecular formula C36H72O and a molecular weight of 520.97 g/mol. Its IUPAC name is (E)-3,7,11,15,20,24,28-heptamethylnonacos-2-en-1-ol.
| Compound Name | (E)-3,7,11,15,20,24,28-heptamethylnonacos-2-en-1-ol |
|---|---|
| PubChem CID | 174796442 |
| Molecular Formula | C36H72O |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.56 |
| IUPAC Name | (E)-3,7,11,15,20,24,28-heptamethylnonacos-2-en-1-ol |
| SMILES | C/C(=C\CO)CCCC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C36H72O/c1-30(2)16-11-19-33(5)22-12-20-31(3)17-9-10-18-32(4)21-13-23-34(6)24-14-25-35(7)26-15-27-36(8)28-29-37/h28,30-35,37H,9-27,29H2,1-8H3/b36-28+ |
| InChIKey | XBWJDUHHUGKFRM-FDEZRRJOSA-N |
| XLogP | 12.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|