C31H62O3 — CID 162032008
methanol;3,7,11-trimethyldodecan-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 162032008) has the molecular formula C31H62O3 and a molecular weight of 482.83 g/mol. Its IUPAC name is methanol;3,7,11-trimethyldodecan-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | methanol;3,7,11-trimethyldodecan-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 162032008 |
| Molecular Formula | C31H62O3 |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.47 |
| IUPAC Name | methanol;3,7,11-trimethyldodecan-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO.CC(C)CCCC(C)CCCC(C)CCO.CO |
| InChI | InChI=1S/C15H32O.C15H26O.CH4O/c2*1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;1-2/h13-16H,5-12H2,1-4H3;7,9,11,16H,5-6,8,10,12H2,1-4H3;2H,1H3/b;14-9+,15-11+; |
| InChIKey | YWDNIWNZTAITNH-BAZMJXSDSA-N |
| XLogP | 8.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|