C20H36O — CID 122388579
(2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trien-1-ol (PubChem CID 122388579) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trien-1-ol.
| Compound Name | (2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trien-1-ol |
|---|---|
| PubChem CID | 122388579 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (2E,6E,11S)-3,7,11,15-tetramethylhexadeca-2,6,14-trien-1-ol |
| SMILES | CC(C)=CCC[C@@H](C)CCC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C20H36O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,13,15,18,21H,6-8,10-12,14,16H2,1-5H3/b19-13+,20-15+/t18-/m1/s1 |
| InChIKey | MRGRKBSPIBREBY-DXPCXQIRSA-N |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|