C22H36 — CID 140820993
(4E,8E)-5,9,13,17-tetramethyloctadeca-4,8,16-trien-1-yne (PubChem CID 140820993) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (4E,8E)-5,9,13,17-tetramethyloctadeca-4,8,16-trien-1-yne.
| Compound Name | (4E,8E)-5,9,13,17-tetramethyloctadeca-4,8,16-trien-1-yne |
|---|---|
| PubChem CID | 140820993 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (4E,8E)-5,9,13,17-tetramethyloctadeca-4,8,16-trien-1-yne |
| SMILES | C#CC/C=C(\C)CC/C=C(\C)CCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C22H36/c1-7-8-13-20(4)15-10-17-22(6)18-11-16-21(5)14-9-12-19(2)3/h1,12-13,17,21H,8-11,14-16,18H2,2-6H3/b20-13+,22-17+ |
| InChIKey | CKUAUXHCFBQCRA-VFPVYGPPSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|