C18H36 — CID 58292425
(E)-2,6,10,13-tetramethyltetradec-6-ene (PubChem CID 58292425) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is (E)-2,6,10,13-tetramethyltetradec-6-ene.
| Compound Name | (E)-2,6,10,13-tetramethyltetradec-6-ene |
|---|---|
| PubChem CID | 58292425 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | (E)-2,6,10,13-tetramethyltetradec-6-ene |
| SMILES | C/C(=C\CCC(C)CCC(C)C)CCCC(C)C |
| InChI | InChI=1S/C18H36/c1-15(2)9-7-10-17(5)11-8-12-18(6)14-13-16(3)4/h11,15-16,18H,7-10,12-14H2,1-6H3/b17-11+ |
| InChIKey | MODFXWJQSXHMHT-GZTJUZNOSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|