C12H25N — CID 83162608
(Z)-N,4,8-trimethylnon-3-en-1-amine (PubChem CID 83162608) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (Z)-N,4,8-trimethylnon-3-en-1-amine.
| Compound Name | (Z)-N,4,8-trimethylnon-3-en-1-amine |
|---|---|
| PubChem CID | 83162608 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (Z)-N,4,8-trimethylnon-3-en-1-amine |
| SMILES | CNCC/C=C(/C)CCCC(C)C |
| InChI | InChI=1S/C12H25N/c1-11(2)7-5-8-12(3)9-6-10-13-4/h9,11,13H,5-8,10H2,1-4H3/b12-9- |
| InChIKey | RSHGSCKTLGYRJH-XFXZXTDPSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|