C11H22 — CID 22743489
(E)-4,8-dimethylnon-3-ene (PubChem CID 22743489) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is (E)-4,8-dimethylnon-3-ene.
| Compound Name | (E)-4,8-dimethylnon-3-ene |
|---|---|
| PubChem CID | 22743489 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (E)-4,8-dimethylnon-3-ene |
| SMILES | CC/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C11H22/c1-5-7-11(4)9-6-8-10(2)3/h7,10H,5-6,8-9H2,1-4H3/b11-7+ |
| InChIKey | ZRHQQXNICFTOLV-YRNVUSSQSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|