C15H28Cl2Mg — CID 174246815
magnesium;3,7,11-trimethyldodeca-2,6-diene;dichloride (PubChem CID 174246815) has the molecular formula C15H28Cl2Mg and a molecular weight of 303.60 g/mol. Its IUPAC name is magnesium;3,7,11-trimethyldodeca-2,6-diene;dichloride.
| Compound Name | magnesium;3,7,11-trimethyldodeca-2,6-diene;dichloride |
|---|---|
| PubChem CID | 174246815 |
| Molecular Formula | C15H28Cl2Mg |
| Molecular Weight | 303.60 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | magnesium;3,7,11-trimethyldodeca-2,6-diene;dichloride |
| SMILES | CC=C(C)CCC=C(C)CCCC(C)C.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C15H28.2ClH.Mg/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3;;;/h6,12-13H,7-11H2,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RNUHQFUSDGTLFW-UHFFFAOYSA-L |
| XLogP | -0.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.60 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|