C24H42 — CID 58369783
(6E,10E,14E)-2,6,10,15,18-pentamethylnonadeca-2,6,10,14-tetraene (PubChem CID 58369783) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is (6E,10E,14E)-2,6,10,15,18-pentamethylnonadeca-2,6,10,14-tetraene.
| Compound Name | (6E,10E,14E)-2,6,10,15,18-pentamethylnonadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 58369783 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | (6E,10E,14E)-2,6,10,15,18-pentamethylnonadeca-2,6,10,14-tetraene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CCC(C)C |
| InChI | InChI=1S/C24H42/c1-20(2)12-10-15-23(6)17-11-16-22(5)13-8-9-14-24(7)19-18-21(3)4/h12-14,17,21H,8-11,15-16,18-19H2,1-7H3/b22-13+,23-17+,24-14+ |
| InChIKey | IMLKTRNXXDBKFG-PLARQWSSSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|