C20H36S — CID 144519189
(2E,6E)-3,7,11-trimethyl-1-(3-methylbutylsulfanyl)dodeca-2,6,10-triene (PubChem CID 144519189) has the molecular formula C20H36S and a molecular weight of 308.58 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-1-(3-methylbutylsulfanyl)dodeca-2,6,10-triene.
| Compound Name | (2E,6E)-3,7,11-trimethyl-1-(3-methylbutylsulfanyl)dodeca-2,6,10-triene |
|---|---|
| PubChem CID | 144519189 |
| Molecular Formula | C20H36S |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-1-(3-methylbutylsulfanyl)dodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCC(C)C |
| InChI | InChI=1S/C20H36S/c1-17(2)9-7-10-19(5)11-8-12-20(6)14-16-21-15-13-18(3)4/h9,11,14,18H,7-8,10,12-13,15-16H2,1-6H3/b19-11+,20-14+ |
| InChIKey | WNQJAJBGLGIWKX-CXBQNDLOSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|